C44H57N3O3 — CID 102176871
(4S)-2-[3,5-bis[(4S)-5,5-diethyl-4-propan-2-yl-4H-1,3-oxazol-2-yl]phenyl]-5,5-diphenyl-4-propan-2-yl-4H-1,3-oxazole (PubChem CID 102176871) has the molecular formula C44H57N3O3 and a molecular weight of 675.96 g/mol. Its IUPAC name is (4S)-2-[3,5-bis[(4S)-5,5-diethyl-4-propan-2-yl-4H-1,3-oxazol-2-yl]phenyl]-5,5-diphenyl-4-propan-2-yl-4H-1,3-oxazole.
| Compound Name | (4S)-2-[3,5-bis[(4S)-5,5-diethyl-4-propan-2-yl-4H-1,3-oxazol-2-yl]phenyl]-5,5-diphenyl-4-propan-2-yl-4H-1,3-oxazole |
|---|---|
| PubChem CID | 102176871 |
| Molecular Formula | C44H57N3O3 |
| Molecular Weight | 675.96 g/mol |
| Exact Mass | 675.44 |
| IUPAC Name | (4S)-2-[3,5-bis[(4S)-5,5-diethyl-4-propan-2-yl-4H-1,3-oxazol-2-yl]phenyl]-5,5-diphenyl-4-propan-2-yl-4H-1,3-oxazole |
| SMILES | CCC1(CC)OC(c2cc(C3=N[C@@H](C(C)C)C(CC)(CC)O3)cc(C3=N[C@@H](C(C)C)C(c4ccccc4)(c4ccccc4)O3)c2)=N[C@H]1C(C)C |
| InChI | InChI=1S/C44H57N3O3/c1-11-42(12-2)36(28(5)6)45-39(48-42)31-25-32(40-46-37(29(7)8)43(13-3,14-4)49-40)27-33(26-31)41-47-38(30(9)10)44(50-41,34-21-17-15-18-22-34)35-23-19-16-20-24-35/h15-30,36-38H,11-14H2,1-10H3/t36-,37-,38-/m0/s1 |
| InChIKey | CHWDIQKOSDFEBD-QXUSSCGESA-N |
| XLogP | 10.15 |
| TPSA | 64.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.96 |
| LogP ≤ 5 | 10.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |