C25H24BrNO — CID 102050789
(4S)-2-(2-bromophenyl)-4-tert-butyl-5,5-diphenyl-4H-1,3-oxazole (PubChem CID 102050789) has the molecular formula C25H24BrNO and a molecular weight of 434.38 g/mol. Its IUPAC name is (4S)-2-(2-bromophenyl)-4-tert-butyl-5,5-diphenyl-4H-1,3-oxazole.
| Compound Name | (4S)-2-(2-bromophenyl)-4-tert-butyl-5,5-diphenyl-4H-1,3-oxazole |
|---|---|
| PubChem CID | 102050789 |
| Molecular Formula | C25H24BrNO |
| Molecular Weight | 434.38 g/mol |
| Exact Mass | 433.10 |
| IUPAC Name | (4S)-2-(2-bromophenyl)-4-tert-butyl-5,5-diphenyl-4H-1,3-oxazole |
| SMILES | CC(C)(C)[C@@H]1N=C(c2ccccc2Br)OC1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H24BrNO/c1-24(2,3)23-25(18-12-6-4-7-13-18,19-14-8-5-9-15-19)28-22(27-23)20-16-10-11-17-21(20)26/h4-17,23H,1-3H3/t23-/m0/s1 |
| InChIKey | IPHXORATWIMBGI-QHCPKHFHSA-N |
| XLogP | 6.58 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.38 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |