C21H27NO — CID 102295089
(4S)-4-tert-butyl-2,2-dimethyl-5,5-diphenyl-1,3-oxazolidine (PubChem CID 102295089) has the molecular formula C21H27NO and a molecular weight of 309.45 g/mol. Its IUPAC name is (4S)-4-tert-butyl-2,2-dimethyl-5,5-diphenyl-1,3-oxazolidine.
| Compound Name | (4S)-4-tert-butyl-2,2-dimethyl-5,5-diphenyl-1,3-oxazolidine |
|---|---|
| PubChem CID | 102295089 |
| Molecular Formula | C21H27NO |
| Molecular Weight | 309.45 g/mol |
| Exact Mass | 309.21 |
| IUPAC Name | (4S)-4-tert-butyl-2,2-dimethyl-5,5-diphenyl-1,3-oxazolidine |
| SMILES | CC1(C)N[C@@H](C(C)(C)C)C(c2ccccc2)(c2ccccc2)O1 |
| InChI | InChI=1S/C21H27NO/c1-19(2,3)18-21(23-20(4,5)22-18,16-12-8-6-9-13-16)17-14-10-7-11-15-17/h6-15,18,22H,1-5H3/t18-/m0/s1 |
| InChIKey | MIZMQIKRIRPZQU-SFHVURJKSA-N |
| XLogP | 4.70 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.45 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |