C23H21NO2S — CID 136843956
2-[(4R)-4-(methylsulfanylmethyl)-5,5-diphenyl-4H-1,3-oxazol-2-yl]phenol (PubChem CID 136843956) has the molecular formula C23H21NO2S and a molecular weight of 375.49 g/mol. Its IUPAC name is 2-[(4R)-4-(methylsulfanylmethyl)-5,5-diphenyl-4H-1,3-oxazol-2-yl]phenol.
| Compound Name | 2-[(4R)-4-(methylsulfanylmethyl)-5,5-diphenyl-4H-1,3-oxazol-2-yl]phenol |
|---|---|
| PubChem CID | 136843956 |
| Molecular Formula | C23H21NO2S |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | 2-[(4R)-4-(methylsulfanylmethyl)-5,5-diphenyl-4H-1,3-oxazol-2-yl]phenol |
| SMILES | CSC[C@@H]1N=C(c2ccccc2O)OC1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H21NO2S/c1-27-16-21-23(17-10-4-2-5-11-17,18-12-6-3-7-13-18)26-22(24-21)19-14-8-9-15-20(19)25/h2-15,21,25H,16H2,1H3/t21-/m0/s1 |
| InChIKey | USUTTWJCFDQZDK-NRFANRHFSA-N |
| XLogP | 4.84 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |