About magnesium;diphenylphosphanide;chloride
magnesium;diphenylphosphanide;chloride (PubChem CID 102180138) has the molecular formula C12H10ClMgP
and a molecular weight of 244.94 g/mol. Its IUPAC name is magnesium;diphenylphosphanide;chloride.
Molecular Properties
| Compound Name | magnesium;diphenylphosphanide;chloride |
| PubChem CID | 102180138 |
| Molecular Formula | C12H10ClMgP |
| Molecular Weight | 244.94 g/mol |
| Exact Mass | 244.01 |
| IUPAC Name | magnesium;diphenylphosphanide;chloride |
| SMILES | [Cl-].[Mg+2].c1ccc([P-]c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10P.ClH.Mg/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;;/h1-10H;1H;/q-1;;+2/p-1 |
| InChIKey | JDOARSXWPAFWQC-UHFFFAOYSA-M |
| XLogP | -0.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.94 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze magnesium;diphenylphosphanide;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;diphenylphosphanide;chloride?
The IUPAC name of magnesium;diphenylphosphanide;chloride (CID 102180138) is magnesium;diphenylphosphanide;chloride.
What is the SMILES notation for magnesium;diphenylphosphanide;chloride?
The canonical SMILES for magnesium;diphenylphosphanide;chloride is [Cl-].[Mg+2].c1ccc([P-]c2ccccc2)cc1.
What is the InChIKey of magnesium;diphenylphosphanide;chloride?
The InChIKey is JDOARSXWPAFWQC-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H10P.ClH.Mg/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;;/h1-10H;1H;/q-1;;+2/p-1.
What are the key properties of magnesium;diphenylphosphanide;chloride?
magnesium;diphenylphosphanide;chloride has a molecular weight of 244.94 g/mol, XLogP of -0.79, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;diphenylphosphanide;chloride is sourced from PubChem (CID 102180138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).