About magnesium bis(diphenylphosphanide)
magnesium bis(diphenylphosphanide) (PubChem CID 18968247) has the molecular formula C24H20MgP2
and a molecular weight of 394.68 g/mol. Its IUPAC name is magnesium bis(diphenylphosphanide).
Molecular Properties
| Compound Name | magnesium bis(diphenylphosphanide) |
| PubChem CID | 18968247 |
| Molecular Formula | C24H20MgP2 |
| Molecular Weight | 394.68 g/mol |
| Exact Mass | 394.09 |
| IUPAC Name | magnesium bis(diphenylphosphanide) |
| SMILES | [Mg+2].c1ccc([P-]c2ccccc2)cc1.c1ccc([P-]c2ccccc2)cc1 |
| InChI | InChI=1S/2C12H10P.Mg/c2*1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;/h2*1-10H;/q2*-1;+2 |
| InChIKey | SNGGYTWKRNTGLR-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.68 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze magnesium bis(diphenylphosphanide) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium bis(diphenylphosphanide)?
The IUPAC name of magnesium bis(diphenylphosphanide) (CID 18968247) is magnesium bis(diphenylphosphanide).
What is the SMILES notation for magnesium bis(diphenylphosphanide)?
The canonical SMILES for magnesium bis(diphenylphosphanide) is [Mg+2].c1ccc([P-]c2ccccc2)cc1.c1ccc([P-]c2ccccc2)cc1.
What is the InChIKey of magnesium bis(diphenylphosphanide)?
The InChIKey is SNGGYTWKRNTGLR-UHFFFAOYSA-N. The full InChI is InChI=1S/2C12H10P.Mg/c2*1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;/h2*1-10H;/q2*-1;+2.
What are the key properties of magnesium bis(diphenylphosphanide)?
magnesium bis(diphenylphosphanide) has a molecular weight of 394.68 g/mol, XLogP of 4.79, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium bis(diphenylphosphanide) is sourced from PubChem (CID 18968247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).