About dichloronickel(2+);bis(diphenylphosphanide)
dichloronickel(2+);bis(diphenylphosphanide) (PubChem CID 139239536) has the molecular formula C24H20Cl2NiP2
and a molecular weight of 499.97 g/mol. Its IUPAC name is dichloronickel(2+);bis(diphenylphosphanide).
Molecular Properties
| Compound Name | dichloronickel(2+);bis(diphenylphosphanide) |
| PubChem CID | 139239536 |
| Molecular Formula | C24H20Cl2NiP2 |
| Molecular Weight | 499.97 g/mol |
| Exact Mass | 497.98 |
| IUPAC Name | dichloronickel(2+);bis(diphenylphosphanide) |
| SMILES | Cl[Ni+2]Cl.c1ccc([P-]c2ccccc2)cc1.c1ccc([P-]c2ccccc2)cc1 |
| InChI | InChI=1S/2C12H10P.2ClH.Ni/c2*1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;;;/h2*1-10H;2*1H;/q2*-1;;;+4/p-2 |
| InChIKey | WETILHVHYFKOLH-UHFFFAOYSA-L |
| XLogP | 6.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 499.97 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dichloronickel(2+);bis(diphenylphosphanide) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloronickel(2+);bis(diphenylphosphanide)?
The IUPAC name of dichloronickel(2+);bis(diphenylphosphanide) (CID 139239536) is dichloronickel(2+);bis(diphenylphosphanide).
What is the SMILES notation for dichloronickel(2+);bis(diphenylphosphanide)?
The canonical SMILES for dichloronickel(2+);bis(diphenylphosphanide) is Cl[Ni+2]Cl.c1ccc([P-]c2ccccc2)cc1.c1ccc([P-]c2ccccc2)cc1.
What is the InChIKey of dichloronickel(2+);bis(diphenylphosphanide)?
The InChIKey is WETILHVHYFKOLH-UHFFFAOYSA-L. The full InChI is InChI=1S/2C12H10P.2ClH.Ni/c2*1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;;;/h2*1-10H;2*1H;/q2*-1;;;+4/p-2.
What are the key properties of dichloronickel(2+);bis(diphenylphosphanide)?
dichloronickel(2+);bis(diphenylphosphanide) has a molecular weight of 499.97 g/mol, XLogP of 6.54, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dichloronickel(2+);bis(diphenylphosphanide) is sourced from PubChem (CID 139239536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).