C37H42N6O2 — CID 102180291
2,6-bis[[bis[(6-methyl-2-pyridinyl)methyl]amino]methyl]-4-methoxyphenol (PubChem CID 102180291) has the molecular formula C37H42N6O2 and a molecular weight of 602.78 g/mol. Its IUPAC name is 2,6-bis[[bis[(6-methyl-2-pyridinyl)methyl]amino]methyl]-4-methoxyphenol.
| Compound Name | 2,6-bis[[bis[(6-methyl-2-pyridinyl)methyl]amino]methyl]-4-methoxyphenol |
|---|---|
| PubChem CID | 102180291 |
| Molecular Formula | C37H42N6O2 |
| Molecular Weight | 602.78 g/mol |
| Exact Mass | 602.34 |
| IUPAC Name | 2,6-bis[[bis[(6-methyl-2-pyridinyl)methyl]amino]methyl]-4-methoxyphenol |
| SMILES | COc1cc(CN(Cc2cccc(C)n2)Cc2cccc(C)n2)c(O)c(CN(Cc2cccc(C)n2)Cc2cccc(C)n2)c1 |
| InChI | InChI=1S/C37H42N6O2/c1-26-10-6-14-32(38-26)22-42(23-33-15-7-11-27(2)39-33)20-30-18-36(45-5)19-31(37(30)44)21-43(24-34-16-8-12-28(3)40-34)25-35-17-9-13-29(4)41-35/h6-19,44H,20-25H2,1-5H3 |
| InChIKey | KHWBFUMWVZGRIC-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 87.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.78 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|