C36H35Cl4N7O3 — CID 162510047
methyl 2-amino-3-[3,5-bis[[bis[(6-chloro-2-pyridinyl)methyl]amino]methyl]-4-hydroxyphenyl]propanoate (PubChem CID 162510047) has the molecular formula C36H35Cl4N7O3 and a molecular weight of 755.53 g/mol. Its IUPAC name is methyl 2-amino-3-[3,5-bis[[bis[(6-chloro-2-pyridinyl)methyl]amino]methyl]-4-hydroxyphenyl]propanoate.
| Compound Name | methyl 2-amino-3-[3,5-bis[[bis[(6-chloro-2-pyridinyl)methyl]amino]methyl]-4-hydroxyphenyl]propanoate |
|---|---|
| PubChem CID | 162510047 |
| Molecular Formula | C36H35Cl4N7O3 |
| Molecular Weight | 755.53 g/mol |
| Exact Mass | 753.16 |
| IUPAC Name | methyl 2-amino-3-[3,5-bis[[bis[(6-chloro-2-pyridinyl)methyl]amino]methyl]-4-hydroxyphenyl]propanoate |
| SMILES | COC(=O)C(N)Cc1cc(CN(Cc2cccc(Cl)n2)Cc2cccc(Cl)n2)c(O)c(CN(Cc2cccc(Cl)n2)Cc2cccc(Cl)n2)c1 |
| InChI | InChI=1S/C36H35Cl4N7O3/c1-50-36(49)30(41)16-23-14-24(17-46(19-26-6-2-10-31(37)42-26)20-27-7-3-11-32(38)43-27)35(48)25(15-23)18-47(21-28-8-4-12-33(39)44-28)22-29-9-5-13-34(40)45-29/h2-15,30,48H,16-22,41H2,1H3 |
| InChIKey | HIZJJDFUVAPJRK-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 130.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 755.53 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|