C24H28CuFN3O+2 — CID 71816328
copper 2-tert-butyl-4-fluoro-6-[[(6-methyl-2-pyridinyl)methyl-(pyridin-2-ylmethyl)amino]methyl]phenol (PubChem CID 71816328) has the molecular formula C24H28CuFN3O+2 and a molecular weight of 457.05 g/mol. Its IUPAC name is copper 2-tert-butyl-4-fluoro-6-[[(6-methyl-2-pyridinyl)methyl-(pyridin-2-ylmethyl)amino]methyl]phenol.
| Compound Name | copper 2-tert-butyl-4-fluoro-6-[[(6-methyl-2-pyridinyl)methyl-(pyridin-2-ylmethyl)amino]methyl]phenol |
|---|---|
| PubChem CID | 71816328 |
| Molecular Formula | C24H28CuFN3O+2 |
| Molecular Weight | 457.05 g/mol |
| Exact Mass | 456.15 |
| IUPAC Name | copper 2-tert-butyl-4-fluoro-6-[[(6-methyl-2-pyridinyl)methyl-(pyridin-2-ylmethyl)amino]methyl]phenol |
| SMILES | Cc1cccc(CN(Cc2ccccn2)Cc2cc(F)cc(C(C)(C)C)c2O)n1.[Cu+2] |
| InChI | InChI=1S/C24H28FN3O.Cu/c1-17-8-7-10-21(27-17)16-28(15-20-9-5-6-11-26-20)14-18-12-19(25)13-22(23(18)29)24(2,3)4;/h5-13,29H,14-16H2,1-4H3;/q;+2 |
| InChIKey | QGPIJXBXMLJTDP-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.05 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|