C31H39N3O — CID 91381800
2,4-ditert-butyl-6-[[2-(1H-indol-3-yl)ethyl-(pyridin-2-ylmethyl)amino]methyl]phenol (PubChem CID 91381800) has the molecular formula C31H39N3O and a molecular weight of 469.67 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[[2-(1H-indol-3-yl)ethyl-(pyridin-2-ylmethyl)amino]methyl]phenol.
| Compound Name | 2,4-ditert-butyl-6-[[2-(1H-indol-3-yl)ethyl-(pyridin-2-ylmethyl)amino]methyl]phenol |
|---|---|
| PubChem CID | 91381800 |
| Molecular Formula | C31H39N3O |
| Molecular Weight | 469.67 g/mol |
| Exact Mass | 469.31 |
| IUPAC Name | 2,4-ditert-butyl-6-[[2-(1H-indol-3-yl)ethyl-(pyridin-2-ylmethyl)amino]methyl]phenol |
| SMILES | CC(C)(C)c1cc(CN(CCc2c[nH]c3ccccc23)Cc2ccccn2)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C31H39N3O/c1-30(2,3)24-17-23(29(35)27(18-24)31(4,5)6)20-34(21-25-11-9-10-15-32-25)16-14-22-19-33-28-13-8-7-12-26(22)28/h7-13,15,17-19,33,35H,14,16,20-21H2,1-6H3 |
| InChIKey | NIXCLJUJIHGKFZ-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 52.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.67 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|