C32H44N4O — CID 102107273
2,4-ditert-butyl-6-[[2-(1H-indol-3-yl)ethyl-[(1,4,5-trimethylimidazol-2-yl)methyl]amino]methyl]phenol (PubChem CID 102107273) has the molecular formula C32H44N4O and a molecular weight of 500.73 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[[2-(1H-indol-3-yl)ethyl-[(1,4,5-trimethylimidazol-2-yl)methyl]amino]methyl]phenol.
| Compound Name | 2,4-ditert-butyl-6-[[2-(1H-indol-3-yl)ethyl-[(1,4,5-trimethylimidazol-2-yl)methyl]amino]methyl]phenol |
|---|---|
| PubChem CID | 102107273 |
| Molecular Formula | C32H44N4O |
| Molecular Weight | 500.73 g/mol |
| Exact Mass | 500.35 |
| IUPAC Name | 2,4-ditert-butyl-6-[[2-(1H-indol-3-yl)ethyl-[(1,4,5-trimethylimidazol-2-yl)methyl]amino]methyl]phenol |
| SMILES | Cc1nc(CN(CCc2c[nH]c3ccccc23)Cc2cc(C(C)(C)C)cc(C(C)(C)C)c2O)n(C)c1C |
| InChI | InChI=1S/C32H44N4O/c1-21-22(2)35(9)29(34-21)20-36(15-14-23-18-33-28-13-11-10-12-26(23)28)19-24-16-25(31(3,4)5)17-27(30(24)37)32(6,7)8/h10-13,16-18,33,37H,14-15,19-20H2,1-9H3 |
| InChIKey | YDTHGQBPANNYDY-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 57.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.73 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|