C19H21N3O — CID 135248329
N-[(4-hydroxyphenyl)methyl]-N-[2-(1H-indol-3-yl)ethyl]-N'-methylmethanimidamide (PubChem CID 135248329) has the molecular formula C19H21N3O and a molecular weight of 307.40 g/mol. Its IUPAC name is N-[(4-hydroxyphenyl)methyl]-N-[2-(1H-indol-3-yl)ethyl]-N'-methylmethanimidamide.
| Compound Name | N-[(4-hydroxyphenyl)methyl]-N-[2-(1H-indol-3-yl)ethyl]-N'-methylmethanimidamide |
|---|---|
| PubChem CID | 135248329 |
| Molecular Formula | C19H21N3O |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | N-[(4-hydroxyphenyl)methyl]-N-[2-(1H-indol-3-yl)ethyl]-N'-methylmethanimidamide |
| SMILES | C/N=C/N(CCc1c[nH]c2ccccc12)Cc1ccc(O)cc1 |
| InChI | InChI=1S/C19H21N3O/c1-20-14-22(13-15-6-8-17(23)9-7-15)11-10-16-12-21-19-5-3-2-4-18(16)19/h2-9,12,14,21,23H,10-11,13H2,1H3/b20-14+ |
| InChIKey | PRKBNGSMPPFZIG-XSFVSMFZSA-N |
| XLogP | 3.58 |
| TPSA | 51.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|