C20H27N3O — CID 143831830
2-(1H-indol-3-yl)-N-methylethanamine;4-[2-(methylamino)ethyl]phenol (PubChem CID 143831830) has the molecular formula C20H27N3O and a molecular weight of 325.46 g/mol. Its IUPAC name is 2-(1H-indol-3-yl)-N-methylethanamine;4-[2-(methylamino)ethyl]phenol.
| Compound Name | 2-(1H-indol-3-yl)-N-methylethanamine;4-[2-(methylamino)ethyl]phenol |
|---|---|
| PubChem CID | 143831830 |
| Molecular Formula | C20H27N3O |
| Molecular Weight | 325.46 g/mol |
| Exact Mass | 325.22 |
| IUPAC Name | 2-(1H-indol-3-yl)-N-methylethanamine;4-[2-(methylamino)ethyl]phenol |
| SMILES | CNCCc1c[nH]c2ccccc12.CNCCc1ccc(O)cc1 |
| InChI | InChI=1S/C11H14N2.C9H13NO/c1-12-7-6-9-8-13-11-5-3-2-4-10(9)11;1-10-7-6-8-2-4-9(11)5-3-8/h2-5,8,12-13H,6-7H2,1H3;2-5,10-11H,6-7H2,1H3 |
| InChIKey | LHVBHDKGKDIHQU-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 60.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.46 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |