C17H17NO4 — CID 175587008
2-benzofuran-1,3-dione;4-[2-(methylamino)ethyl]phenol (PubChem CID 175587008) has the molecular formula C17H17NO4 and a molecular weight of 299.33 g/mol. Its IUPAC name is 2-benzofuran-1,3-dione;4-[2-(methylamino)ethyl]phenol.
| Compound Name | 2-benzofuran-1,3-dione;4-[2-(methylamino)ethyl]phenol |
|---|---|
| PubChem CID | 175587008 |
| Molecular Formula | C17H17NO4 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 2-benzofuran-1,3-dione;4-[2-(methylamino)ethyl]phenol |
| SMILES | CNCCc1ccc(O)cc1.O=C1OC(=O)c2ccccc21 |
| InChI | InChI=1S/C9H13NO.C8H4O3/c1-10-7-6-8-2-4-9(11)5-3-8;9-7-5-3-1-2-4-6(5)8(10)11-7/h2-5,10-11H,6-7H2,1H3;1-4H |
| InChIKey | ZMOIOXDVSMTFKF-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|