C26H31N3O — CID 158014002
2-(1H-indol-3-yl)-N-methylethanamine;(E)-1-methoxy-N-methyl-3-naphthalen-2-ylprop-1-en-2-amine (PubChem CID 158014002) has the molecular formula C26H31N3O and a molecular weight of 401.55 g/mol. Its IUPAC name is 2-(1H-indol-3-yl)-N-methylethanamine;(E)-1-methoxy-N-methyl-3-naphthalen-2-ylprop-1-en-2-amine.
| Compound Name | 2-(1H-indol-3-yl)-N-methylethanamine;(E)-1-methoxy-N-methyl-3-naphthalen-2-ylprop-1-en-2-amine |
|---|---|
| PubChem CID | 158014002 |
| Molecular Formula | C26H31N3O |
| Molecular Weight | 401.55 g/mol |
| Exact Mass | 401.25 |
| IUPAC Name | 2-(1H-indol-3-yl)-N-methylethanamine;(E)-1-methoxy-N-methyl-3-naphthalen-2-ylprop-1-en-2-amine |
| SMILES | CN/C(=C/OC)Cc1ccc2ccccc2c1.CNCCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C15H17NO.C11H14N2/c1-16-15(11-17-2)10-12-7-8-13-5-3-4-6-14(13)9-12;1-12-7-6-9-8-13-11-5-3-2-4-10(9)11/h3-9,11,16H,10H2,1-2H3;2-5,8,12-13H,6-7H2,1H3/b15-11+; |
| InChIKey | FFFWBSFHYZOEJT-KRWCAOSLSA-N |
| XLogP | 5.02 |
| TPSA | 49.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.55 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|