C46H60N2O2 — CID 102075905
2-[[[(2R)-1,1-bis(4-tert-butylphenyl)-1-hydroxy-3-(1H-indol-3-yl)propan-2-yl]amino]methyl]-4,6-ditert-butylphenol (PubChem CID 102075905) has the molecular formula C46H60N2O2 and a molecular weight of 673.00 g/mol. Its IUPAC name is 2-[[[(2R)-1,1-bis(4-tert-butylphenyl)-1-hydroxy-3-(1H-indol-3-yl)propan-2-yl]amino]methyl]-4,6-ditert-butylphenol.
| Compound Name | 2-[[[(2R)-1,1-bis(4-tert-butylphenyl)-1-hydroxy-3-(1H-indol-3-yl)propan-2-yl]amino]methyl]-4,6-ditert-butylphenol |
|---|---|
| PubChem CID | 102075905 |
| Molecular Formula | C46H60N2O2 |
| Molecular Weight | 673.00 g/mol |
| Exact Mass | 672.47 |
| IUPAC Name | 2-[[[(2R)-1,1-bis(4-tert-butylphenyl)-1-hydroxy-3-(1H-indol-3-yl)propan-2-yl]amino]methyl]-4,6-ditert-butylphenol |
| SMILES | CC(C)(C)c1ccc(C(O)(c2ccc(C(C)(C)C)cc2)[C@@H](Cc2c[nH]c3ccccc23)NCc2cc(C(C)(C)C)cc(C(C)(C)C)c2O)cc1 |
| InChI | InChI=1S/C46H60N2O2/c1-42(2,3)32-17-21-34(22-18-32)46(50,35-23-19-33(20-24-35)43(4,5)6)40(26-30-28-47-39-16-14-13-15-37(30)39)48-29-31-25-36(44(7,8)9)27-38(41(31)49)45(10,11)12/h13-25,27-28,40,47-50H,26,29H2,1-12H3/t40-/m1/s1 |
| InChIKey | ABTUXKNPOYNRQG-RRHRGVEJSA-N |
| XLogP | 10.70 |
| TPSA | 68.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.00 |
| LogP ≤ 5 | 10.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|