C21H26N2OS — CID 142868442
2-[(4-tert-butylphenyl)sulfanylamino]-3-(1H-indol-3-yl)propan-1-ol (PubChem CID 142868442) has the molecular formula C21H26N2OS and a molecular weight of 354.52 g/mol. Its IUPAC name is 2-[(4-tert-butylphenyl)sulfanylamino]-3-(1H-indol-3-yl)propan-1-ol.
| Compound Name | 2-[(4-tert-butylphenyl)sulfanylamino]-3-(1H-indol-3-yl)propan-1-ol |
|---|---|
| PubChem CID | 142868442 |
| Molecular Formula | C21H26N2OS |
| Molecular Weight | 354.52 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | 2-[(4-tert-butylphenyl)sulfanylamino]-3-(1H-indol-3-yl)propan-1-ol |
| SMILES | CC(C)(C)c1ccc(SNC(CO)Cc2c[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C21H26N2OS/c1-21(2,3)16-8-10-18(11-9-16)25-23-17(14-24)12-15-13-22-20-7-5-4-6-19(15)20/h4-11,13,17,22-24H,12,14H2,1-3H3 |
| InChIKey | XQXVRBALVQNLKB-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.52 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|