C15H21NO3 — CID 102181956
tert-butyl N-[(1E)-1-(6-oxocyclohexen-1-yl)buta-1,3-dienyl]carbamate (PubChem CID 102181956) has the molecular formula C15H21NO3 and a molecular weight of 263.34 g/mol. Its IUPAC name is tert-butyl N-[(1E)-1-(6-oxocyclohexen-1-yl)buta-1,3-dienyl]carbamate.
| Compound Name | tert-butyl N-[(1E)-1-(6-oxocyclohexen-1-yl)buta-1,3-dienyl]carbamate |
|---|---|
| PubChem CID | 102181956 |
| Molecular Formula | C15H21NO3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | tert-butyl N-[(1E)-1-(6-oxocyclohexen-1-yl)buta-1,3-dienyl]carbamate |
| SMILES | C=C/C=C(/NC(=O)OC(C)(C)C)C1=CCCCC1=O |
| InChI | InChI=1S/C15H21NO3/c1-5-8-12(11-9-6-7-10-13(11)17)16-14(18)19-15(2,3)4/h5,8-9H,1,6-7,10H2,2-4H3,(H,16,18)/b12-8+ |
| InChIKey | KINNVYUJQGONJZ-XYOKQWHBSA-N |
| XLogP | 3.26 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|