C30H36N3+3 — CID 102183349
1-[2-[4-[1-[(4-tert-butylphenyl)methyl]pyridin-1-ium-4-yl]pyridin-1-ium-1-yl]ethyl]-3,5-dimethylpyridin-1-ium (PubChem CID 102183349) has the molecular formula C30H36N3+3 and a molecular weight of 438.64 g/mol. Its IUPAC name is 1-[2-[4-[1-[(4-tert-butylphenyl)methyl]pyridin-1-ium-4-yl]pyridin-1-ium-1-yl]ethyl]-3,5-dimethylpyridin-1-ium.
| Compound Name | 1-[2-[4-[1-[(4-tert-butylphenyl)methyl]pyridin-1-ium-4-yl]pyridin-1-ium-1-yl]ethyl]-3,5-dimethylpyridin-1-ium |
|---|---|
| PubChem CID | 102183349 |
| Molecular Formula | C30H36N3+3 |
| Molecular Weight | 438.64 g/mol |
| Exact Mass | 438.29 |
| IUPAC Name | 1-[2-[4-[1-[(4-tert-butylphenyl)methyl]pyridin-1-ium-4-yl]pyridin-1-ium-1-yl]ethyl]-3,5-dimethylpyridin-1-ium |
| SMILES | Cc1cc(C)c[n+](CC[n+]2ccc(-c3cc[n+](Cc4ccc(C(C)(C)C)cc4)cc3)cc2)c1 |
| InChI | InChI=1S/C30H36N3/c1-24-20-25(2)22-33(21-24)19-18-31-14-10-27(11-15-31)28-12-16-32(17-13-28)23-26-6-8-29(9-7-26)30(3,4)5/h6-17,20-22H,18-19,23H2,1-5H3/q+3 |
| InChIKey | NPZKSDOJHGCKBE-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 11.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.64 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|