C11H12O5 — CID 102183623
methyl 5-methoxy-2,4-dimethyl-3,6-dioxocyclohexa-1,4-diene-1-carboxylate (PubChem CID 102183623) has the molecular formula C11H12O5 and a molecular weight of 224.21 g/mol. Its IUPAC name is methyl 5-methoxy-2,4-dimethyl-3,6-dioxocyclohexa-1,4-diene-1-carboxylate.
| Compound Name | methyl 5-methoxy-2,4-dimethyl-3,6-dioxocyclohexa-1,4-diene-1-carboxylate |
|---|---|
| PubChem CID | 102183623 |
| Molecular Formula | C11H12O5 |
| Molecular Weight | 224.21 g/mol |
| Exact Mass | 224.07 |
| IUPAC Name | methyl 5-methoxy-2,4-dimethyl-3,6-dioxocyclohexa-1,4-diene-1-carboxylate |
| SMILES | COC(=O)C1=C(C)C(=O)C(C)=C(OC)C1=O |
| InChI | InChI=1S/C11H12O5/c1-5-7(11(14)16-4)9(13)10(15-3)6(2)8(5)12/h1-4H3 |
| InChIKey | RDSDAUGTLPOREX-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.21 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|