C24H34N6O6S — CID 102184505
N-[(2S)-1-[[(2S)-1-[[(2R)-1-(3-aminopropylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-3-hydroxy-1-oxopropan-2-yl]amino]-3-hydroxy-1-oxopropan-2-yl]-2-ethylquinoline-3-carboxamide (PubChem CID 102184505) has the molecular formula C24H34N6O6S and a molecular weight of 534.64 g/mol. Its IUPAC name is N-[(2S)-1-[[(2S)-1-[[(2R)-1-(3-aminopropylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-3-hydroxy-1-oxopropan-2-yl]amino]-3-hydroxy-1-oxopropan-2-yl]-2-ethylquinoline-3-carboxamide.
| Compound Name | N-[(2S)-1-[[(2S)-1-[[(2R)-1-(3-aminopropylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-3-hydroxy-1-oxopropan-2-yl]amino]-3-hydroxy-1-oxopropan-2-yl]-2-ethylquinoline-3-carboxamide |
|---|---|
| PubChem CID | 102184505 |
| Molecular Formula | C24H34N6O6S |
| Molecular Weight | 534.64 g/mol |
| Exact Mass | 534.23 |
| IUPAC Name | N-[(2S)-1-[[(2S)-1-[[(2R)-1-(3-aminopropylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-3-hydroxy-1-oxopropan-2-yl]amino]-3-hydroxy-1-oxopropan-2-yl]-2-ethylquinoline-3-carboxamide |
| SMILES | CCc1nc2ccccc2cc1C(=O)N[C@@H](CO)C(=O)N[C@@H](CO)C(=O)N[C@@H](CS)C(=O)NCCCN |
| InChI | InChI=1S/C24H34N6O6S/c1-2-16-15(10-14-6-3-4-7-17(14)27-16)21(33)28-18(11-31)23(35)29-19(12-32)24(36)30-20(13-37)22(34)26-9-5-8-25/h3-4,6-7,10,18-20,31-32,37H,2,5,8-9,11-13,25H2,1H3,(H,26,34)(H,28,33)(H,29,35)(H,30,36)/t18-,19-,20-/m0/s1 |
| InChIKey | AOGWQRUKHYCDJN-UFYCRDLUSA-N |
| XLogP | -1.76 |
| TPSA | 195.77 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.64 |
| LogP ≤ 5 | -1.76 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|