C17H30O2 — CID 102185075
2-[(2S,6S)-6-hexyloxan-2-yl]cyclohexan-1-one (PubChem CID 102185075) has the molecular formula C17H30O2 and a molecular weight of 266.42 g/mol. Its IUPAC name is 2-[(2S,6S)-6-hexyloxan-2-yl]cyclohexan-1-one.
| Compound Name | 2-[(2S,6S)-6-hexyloxan-2-yl]cyclohexan-1-one |
|---|---|
| PubChem CID | 102185075 |
| Molecular Formula | C17H30O2 |
| Molecular Weight | 266.42 g/mol |
| Exact Mass | 266.22 |
| IUPAC Name | 2-[(2S,6S)-6-hexyloxan-2-yl]cyclohexan-1-one |
| SMILES | CCCCCC[C@H]1CCC[C@@H](C2CCCCC2=O)O1 |
| InChI | InChI=1S/C17H30O2/c1-2-3-4-5-9-14-10-8-13-17(19-14)15-11-6-7-12-16(15)18/h14-15,17H,2-13H2,1H3/t14-,15?,17-/m0/s1 |
| InChIKey | FTEIGODEUULNNI-AYWPPYMVSA-N |
| XLogP | 4.65 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.42 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|