C22H29N4O3 — CID 102185137
CID 102185137 (PubChem CID 102185137) has the molecular formula C22H29N4O3 and a molecular weight of 397.50 g/mol.
| Compound Name | CID 102185137 |
|---|---|
| PubChem CID | 102185137 |
| Molecular Formula | C22H29N4O3 |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.22 |
| IUPAC Name | — |
| SMILES | CCOC(C)n1cc(-c2ccc(/C=C/C3=[N+]([O-])C(C)(C)N([O])C3(C)C)cc2)cn1 |
| InChI | InChI=1S/C22H29N4O3/c1-7-29-16(2)24-15-19(14-23-24)18-11-8-17(9-12-18)10-13-20-21(3,4)26(28)22(5,6)25(20)27/h8-16H,7H2,1-6H3/b13-10+ |
| InChIKey | FDFDOKAIHZNJIC-JLHYYAGUSA-N |
| XLogP | 4.25 |
| TPSA | 76.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|