C30H42N8O4 — CID 168925146
cyclohexane;6-[1-(1-ethoxyethyl)pyrazol-4-yl]-5-piperidin-1-yl-[1,2,4]triazolo[1,5-a]pyridin-2-amine;4-nitrophenol (PubChem CID 168925146) has the molecular formula C30H42N8O4 and a molecular weight of 578.72 g/mol. Its IUPAC name is cyclohexane;6-[1-(1-ethoxyethyl)pyrazol-4-yl]-5-piperidin-1-yl-[1,2,4]triazolo[1,5-a]pyridin-2-amine;4-nitrophenol.
| Compound Name | cyclohexane;6-[1-(1-ethoxyethyl)pyrazol-4-yl]-5-piperidin-1-yl-[1,2,4]triazolo[1,5-a]pyridin-2-amine;4-nitrophenol |
|---|---|
| PubChem CID | 168925146 |
| Molecular Formula | C30H42N8O4 |
| Molecular Weight | 578.72 g/mol |
| Exact Mass | 578.33 |
| IUPAC Name | cyclohexane;6-[1-(1-ethoxyethyl)pyrazol-4-yl]-5-piperidin-1-yl-[1,2,4]triazolo[1,5-a]pyridin-2-amine;4-nitrophenol |
| SMILES | C1CCCCC1.CCOC(C)n1cc(-c2ccc3nc(N)nn3c2N2CCCCC2)cn1.O=[N+]([O-])c1ccc(O)cc1 |
| InChI | InChI=1S/C18H25N7O.C6H5NO3.C6H12/c1-3-26-13(2)24-12-14(11-20-24)15-7-8-16-21-18(19)22-25(16)17(15)23-9-5-4-6-10-23;8-6-3-1-5(2-4-6)7(9)10;1-2-4-6-5-3-1/h7-8,11-13H,3-6,9-10H2,1-2H3,(H2,19,22);1-4,8H;1-6H2 |
| InChIKey | BCXITZRSXNKUJF-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 149.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.72 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|