C34H32N2O3S2 — CID 102186947
1-N,3-N-diphenyl-5-[6-(2-thiophen-2-ylthiophen-3-yl)hexoxy]benzene-1,3-dicarboxamide (PubChem CID 102186947) has the molecular formula C34H32N2O3S2 and a molecular weight of 580.78 g/mol. Its IUPAC name is 1-N,3-N-diphenyl-5-[6-(2-thiophen-2-ylthiophen-3-yl)hexoxy]benzene-1,3-dicarboxamide.
| Compound Name | 1-N,3-N-diphenyl-5-[6-(2-thiophen-2-ylthiophen-3-yl)hexoxy]benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 102186947 |
| Molecular Formula | C34H32N2O3S2 |
| Molecular Weight | 580.78 g/mol |
| Exact Mass | 580.19 |
| IUPAC Name | 1-N,3-N-diphenyl-5-[6-(2-thiophen-2-ylthiophen-3-yl)hexoxy]benzene-1,3-dicarboxamide |
| SMILES | O=C(Nc1ccccc1)c1cc(OCCCCCCc2ccsc2-c2cccs2)cc(C(=O)Nc2ccccc2)c1 |
| InChI | InChI=1S/C34H32N2O3S2/c37-33(35-28-13-6-3-7-14-28)26-22-27(34(38)36-29-15-8-4-9-16-29)24-30(23-26)39-19-10-2-1-5-12-25-18-21-41-32(25)31-17-11-20-40-31/h3-4,6-9,11,13-18,20-24H,1-2,5,10,12,19H2,(H,35,37)(H,36,38) |
| InChIKey | VRAQBWMYKKNYCP-UHFFFAOYSA-N |
| XLogP | 9.16 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.78 |
| LogP ≤ 5 | 9.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|