C22H22O5S2 — CID 102186946
5-[6-(2-thiophen-2-ylthiophen-3-yl)hexoxy]benzene-1,3-dicarboxylic acid (PubChem CID 102186946) has the molecular formula C22H22O5S2 and a molecular weight of 430.55 g/mol. Its IUPAC name is 5-[6-(2-thiophen-2-ylthiophen-3-yl)hexoxy]benzene-1,3-dicarboxylic acid.
| Compound Name | 5-[6-(2-thiophen-2-ylthiophen-3-yl)hexoxy]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 102186946 |
| Molecular Formula | C22H22O5S2 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.09 |
| IUPAC Name | 5-[6-(2-thiophen-2-ylthiophen-3-yl)hexoxy]benzene-1,3-dicarboxylic acid |
| SMILES | O=C(O)c1cc(OCCCCCCc2ccsc2-c2cccs2)cc(C(=O)O)c1 |
| InChI | InChI=1S/C22H22O5S2/c23-21(24)16-12-17(22(25)26)14-18(13-16)27-9-4-2-1-3-6-15-8-11-29-20(15)19-7-5-10-28-19/h5,7-8,10-14H,1-4,6,9H2,(H,23,24)(H,25,26) |
| InChIKey | HVQYXNFWLJYDNN-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|