C13H12N2O2 — CID 102187274
10-methyl-9-nitro-5,6-dihydropyrrolo[2,1-a]isoquinoline (PubChem CID 102187274) has the molecular formula C13H12N2O2 and a molecular weight of 228.25 g/mol. Its IUPAC name is 10-methyl-9-nitro-5,6-dihydropyrrolo[2,1-a]isoquinoline.
| Compound Name | 10-methyl-9-nitro-5,6-dihydropyrrolo[2,1-a]isoquinoline |
|---|---|
| PubChem CID | 102187274 |
| Molecular Formula | C13H12N2O2 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | 10-methyl-9-nitro-5,6-dihydropyrrolo[2,1-a]isoquinoline |
| SMILES | Cc1c([N+](=O)[O-])ccc2c1-c1cccn1CC2 |
| InChI | InChI=1S/C13H12N2O2/c1-9-11(15(16)17)5-4-10-6-8-14-7-2-3-12(14)13(9)10/h2-5,7H,6,8H2,1H3 |
| InChIKey | VORVLTRQXHPKDL-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 48.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|