C19H16N2O2 — CID 134849182
16-methyl-17-nitro-9-azatetracyclo[13.4.0.02,7.09,13]nonadeca-1(15),2,4,6,10,12,16,18-octaene (PubChem CID 134849182) has the molecular formula C19H16N2O2 and a molecular weight of 304.35 g/mol. Its IUPAC name is 16-methyl-17-nitro-9-azatetracyclo[13.4.0.02,7.09,13]nonadeca-1(15),2,4,6,10,12,16,18-octaene.
| Compound Name | 16-methyl-17-nitro-9-azatetracyclo[13.4.0.02,7.09,13]nonadeca-1(15),2,4,6,10,12,16,18-octaene |
|---|---|
| PubChem CID | 134849182 |
| Molecular Formula | C19H16N2O2 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | 16-methyl-17-nitro-9-azatetracyclo[13.4.0.02,7.09,13]nonadeca-1(15),2,4,6,10,12,16,18-octaene |
| SMILES | Cc1c([N+](=O)[O-])ccc2c1Cc1cccn1Cc1ccccc1-2 |
| InChI | InChI=1S/C19H16N2O2/c1-13-18-11-15-6-4-10-20(15)12-14-5-2-3-7-16(14)17(18)8-9-19(13)21(22)23/h2-10H,11-12H2,1H3 |
| InChIKey | KXYAEIAZKFIETA-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 48.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|