C30H17NO2 — CID 177480209
27-nitrooctacyclo[20.7.1.02,21.03,11.04,9.012,20.013,18.026,30]triaconta-1(30),2,4,6,8,11,13,15,17,20,22,24,26,28-tetradecaene (PubChem CID 177480209) has the molecular formula C30H17NO2 and a molecular weight of 423.47 g/mol. Its IUPAC name is 27-nitrooctacyclo[20.7.1.02,21.03,11.04,9.012,20.013,18.026,30]triaconta-1(30),2,4,6,8,11,13,15,17,20,22,24,26,28-tetradecaene.
| Compound Name | 27-nitrooctacyclo[20.7.1.02,21.03,11.04,9.012,20.013,18.026,30]triaconta-1(30),2,4,6,8,11,13,15,17,20,22,24,26,28-tetradecaene |
|---|---|
| PubChem CID | 177480209 |
| Molecular Formula | C30H17NO2 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.13 |
| IUPAC Name | 27-nitrooctacyclo[20.7.1.02,21.03,11.04,9.012,20.013,18.026,30]triaconta-1(30),2,4,6,8,11,13,15,17,20,22,24,26,28-tetradecaene |
| SMILES | O=[N+]([O-])c1ccc2c3c(cccc13)-c1c3c(c4c(c1-2)-c1ccccc1C4)-c1ccccc1C3 |
| InChI | InChI=1S/C30H17NO2/c32-31(33)25-13-12-22-27-20(25)10-5-11-21(27)29-24-14-16-6-1-3-8-18(16)26(24)23-15-17-7-2-4-9-19(17)28(23)30(22)29/h1-13H,14-15H2 |
| InChIKey | ZJERPVFLHGNRMO-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|