C21H15NO2 — CID 10662997
1-methyl-11-nitropentacyclo[10.7.1.02,7.08,20.013,18]icosa-2,4,6,8(20),9,11,13,15,17-nonaene (PubChem CID 10662997) has the molecular formula C21H15NO2 and a molecular weight of 313.36 g/mol. Its IUPAC name is 1-methyl-11-nitropentacyclo[10.7.1.02,7.08,20.013,18]icosa-2,4,6,8(20),9,11,13,15,17-nonaene.
| Compound Name | 1-methyl-11-nitropentacyclo[10.7.1.02,7.08,20.013,18]icosa-2,4,6,8(20),9,11,13,15,17-nonaene |
|---|---|
| PubChem CID | 10662997 |
| Molecular Formula | C21H15NO2 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 1-methyl-11-nitropentacyclo[10.7.1.02,7.08,20.013,18]icosa-2,4,6,8(20),9,11,13,15,17-nonaene |
| SMILES | CC12Cc3ccccc3-c3c([N+](=O)[O-])ccc(c31)-c1ccccc12 |
| InChI | InChI=1S/C21H15NO2/c1-21-12-13-6-2-3-7-14(13)19-18(22(23)24)11-10-16(20(19)21)15-8-4-5-9-17(15)21/h2-11H,12H2,1H3 |
| InChIKey | YLFYPXNKAGGLEJ-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|