C24H22OS2 — CID 102187346
(13S)-13-phenylsulfanyl-12-oxa-15-thiatetracyclo[8.6.2.24,7.011,16]icosa-1(16),4,6,10,17,19-hexaene (PubChem CID 102187346) has the molecular formula C24H22OS2 and a molecular weight of 390.57 g/mol. Its IUPAC name is (13S)-13-phenylsulfanyl-12-oxa-15-thiatetracyclo[8.6.2.24,7.011,16]icosa-1(16),4,6,10,17,19-hexaene.
| Compound Name | (13S)-13-phenylsulfanyl-12-oxa-15-thiatetracyclo[8.6.2.24,7.011,16]icosa-1(16),4,6,10,17,19-hexaene |
|---|---|
| PubChem CID | 102187346 |
| Molecular Formula | C24H22OS2 |
| Molecular Weight | 390.57 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | (13S)-13-phenylsulfanyl-12-oxa-15-thiatetracyclo[8.6.2.24,7.011,16]icosa-1(16),4,6,10,17,19-hexaene |
| SMILES | c1ccc(S[C@H]2CSc3c4ccc(c3O2)CCc2ccc(cc2)CC4)cc1 |
| InChI | InChI=1S/C24H22OS2/c1-2-4-21(5-3-1)27-22-16-26-24-20-13-11-18-8-6-17(7-9-18)10-12-19(14-15-20)23(24)25-22/h1-9,14-15,22H,10-13,16H2/t22-/m0/s1 |
| InChIKey | DQKHGUHVKOXROJ-QFIPXVFZSA-N |
| XLogP | 6.17 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.57 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |