C19H12OS — CID 135029452
7H-[1]benzothiolo[3,2-c]xanthene (PubChem CID 135029452) has the molecular formula C19H12OS and a molecular weight of 288.37 g/mol. Its IUPAC name is 7H-[1]benzothiolo[3,2-c]xanthene.
| Compound Name | 7H-[1]benzothiolo[3,2-c]xanthene |
|---|---|
| PubChem CID | 135029452 |
| Molecular Formula | C19H12OS |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | 7H-[1]benzothiolo[3,2-c]xanthene |
| SMILES | c1ccc2c(c1)Cc1ccc3c(sc4ccccc43)c1O2 |
| InChI | InChI=1S/C19H12OS/c1-3-7-16-12(5-1)11-13-9-10-15-14-6-2-4-8-17(14)21-19(15)18(13)20-16/h1-10H,11H2 |
| InChIKey | DFIVXMYNLGFCIO-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |