C46H40Br2N4 — CID 102187677
5-[3,4-bis(4-bromophenyl)-2,5-bis(4-tert-butylphenyl)-6-pyrimidin-5-ylphenyl]pyrimidine (PubChem CID 102187677) has the molecular formula C46H40Br2N4 and a molecular weight of 808.66 g/mol. Its IUPAC name is 5-[3,4-bis(4-bromophenyl)-2,5-bis(4-tert-butylphenyl)-6-pyrimidin-5-ylphenyl]pyrimidine.
| Compound Name | 5-[3,4-bis(4-bromophenyl)-2,5-bis(4-tert-butylphenyl)-6-pyrimidin-5-ylphenyl]pyrimidine |
|---|---|
| PubChem CID | 102187677 |
| Molecular Formula | C46H40Br2N4 |
| Molecular Weight | 808.66 g/mol |
| Exact Mass | 806.16 |
| IUPAC Name | 5-[3,4-bis(4-bromophenyl)-2,5-bis(4-tert-butylphenyl)-6-pyrimidin-5-ylphenyl]pyrimidine |
| SMILES | CC(C)(C)c1ccc(-c2c(-c3ccc(Br)cc3)c(-c3ccc(Br)cc3)c(-c3ccc(C(C)(C)C)cc3)c(-c3cncnc3)c2-c2cncnc2)cc1 |
| InChI | InChI=1S/C46H40Br2N4/c1-45(2,3)35-15-7-29(8-16-35)41-39(31-11-19-37(47)20-12-31)40(32-13-21-38(48)22-14-32)42(30-9-17-36(18-10-30)46(4,5)6)44(34-25-51-28-52-26-34)43(41)33-23-49-27-50-24-33/h7-28H,1-6H3 |
| InChIKey | XTNXLLNVYMOOFA-UHFFFAOYSA-N |
| XLogP | 13.39 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 808.66 |
| LogP ≤ 5 | 13.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |