C24H27N5OS — CID 102190954
4-amino-5-[3-(2-cyclohexylbenzimidazol-1-yl)prop-1-ynyl]-1-[(2R)-thiolan-2-yl]pyrimidin-2-one (PubChem CID 102190954) has the molecular formula C24H27N5OS and a molecular weight of 433.58 g/mol. Its IUPAC name is 4-amino-5-[3-(2-cyclohexylbenzimidazol-1-yl)prop-1-ynyl]-1-[(2R)-thiolan-2-yl]pyrimidin-2-one.
| Compound Name | 4-amino-5-[3-(2-cyclohexylbenzimidazol-1-yl)prop-1-ynyl]-1-[(2R)-thiolan-2-yl]pyrimidin-2-one |
|---|---|
| PubChem CID | 102190954 |
| Molecular Formula | C24H27N5OS |
| Molecular Weight | 433.58 g/mol |
| Exact Mass | 433.19 |
| IUPAC Name | 4-amino-5-[3-(2-cyclohexylbenzimidazol-1-yl)prop-1-ynyl]-1-[(2R)-thiolan-2-yl]pyrimidin-2-one |
| SMILES | Nc1nc(=O)n([C@H]2CCCS2)cc1C#CCn1c(C2CCCCC2)nc2ccccc21 |
| InChI | InChI=1S/C24H27N5OS/c25-22-18(16-29(24(30)27-22)21-13-7-15-31-21)10-6-14-28-20-12-5-4-11-19(20)26-23(28)17-8-2-1-3-9-17/h4-5,11-12,16-17,21H,1-3,7-9,13-15H2,(H2,25,27,30)/t21-/m1/s1 |
| InChIKey | YVTFZCZXUBORKZ-OAQYLSRUSA-N |
| XLogP | 4.30 |
| TPSA | 78.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.58 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|