C13H16N4O3S2 — CID 102449275
N-[3-[4-amino-2-oxo-1-[(2S)-thiolan-2-yl]pyrimidin-5-yl]prop-2-ynyl]ethenesulfonamide (PubChem CID 102449275) has the molecular formula C13H16N4O3S2 and a molecular weight of 340.43 g/mol. Its IUPAC name is N-[3-[4-amino-2-oxo-1-[(2S)-thiolan-2-yl]pyrimidin-5-yl]prop-2-ynyl]ethenesulfonamide.
| Compound Name | N-[3-[4-amino-2-oxo-1-[(2S)-thiolan-2-yl]pyrimidin-5-yl]prop-2-ynyl]ethenesulfonamide |
|---|---|
| PubChem CID | 102449275 |
| Molecular Formula | C13H16N4O3S2 |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | N-[3-[4-amino-2-oxo-1-[(2S)-thiolan-2-yl]pyrimidin-5-yl]prop-2-ynyl]ethenesulfonamide |
| SMILES | C=CS(=O)(=O)NCC#Cc1cn([C@@H]2CCCS2)c(=O)nc1N |
| InChI | InChI=1S/C13H16N4O3S2/c1-2-22(19,20)15-7-3-5-10-9-17(11-6-4-8-21-11)13(18)16-12(10)14/h2,9,11,15H,1,4,6-8H2,(H2,14,16,18)/t11-/m0/s1 |
| InChIKey | SYMNKDMRKWYEOF-NSHDSACASA-N |
| XLogP | 0.27 |
| TPSA | 107.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|