C14H15N5OS — CID 102190944
4-amino-5-(3-imidazol-1-ylprop-1-ynyl)-1-[(2R)-thiolan-2-yl]pyrimidin-2-one (PubChem CID 102190944) has the molecular formula C14H15N5OS and a molecular weight of 301.38 g/mol. Its IUPAC name is 4-amino-5-(3-imidazol-1-ylprop-1-ynyl)-1-[(2R)-thiolan-2-yl]pyrimidin-2-one.
| Compound Name | 4-amino-5-(3-imidazol-1-ylprop-1-ynyl)-1-[(2R)-thiolan-2-yl]pyrimidin-2-one |
|---|---|
| PubChem CID | 102190944 |
| Molecular Formula | C14H15N5OS |
| Molecular Weight | 301.38 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | 4-amino-5-(3-imidazol-1-ylprop-1-ynyl)-1-[(2R)-thiolan-2-yl]pyrimidin-2-one |
| SMILES | Nc1nc(=O)n([C@H]2CCCS2)cc1C#CCn1ccnc1 |
| InChI | InChI=1S/C14H15N5OS/c15-13-11(3-1-6-18-7-5-16-10-18)9-19(14(20)17-13)12-4-2-8-21-12/h5,7,9-10,12H,2,4,6,8H2,(H2,15,17,20)/t12-/m1/s1 |
| InChIKey | LNYPCWYPUAABCS-GFCCVEGCSA-N |
| XLogP | 1.10 |
| TPSA | 78.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.38 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|