C19H18FNO3 — CID 102190979
ethyl 13-fluoro-8-methoxy-2-azatetracyclo[7.6.1.05,16.010,15]hexadeca-5(16),6,8,10(15),11,13-hexaene-2-carboxylate (PubChem CID 102190979) has the molecular formula C19H18FNO3 and a molecular weight of 327.36 g/mol. Its IUPAC name is ethyl 13-fluoro-8-methoxy-2-azatetracyclo[7.6.1.05,16.010,15]hexadeca-5(16),6,8,10(15),11,13-hexaene-2-carboxylate.
| Compound Name | ethyl 13-fluoro-8-methoxy-2-azatetracyclo[7.6.1.05,16.010,15]hexadeca-5(16),6,8,10(15),11,13-hexaene-2-carboxylate |
|---|---|
| PubChem CID | 102190979 |
| Molecular Formula | C19H18FNO3 |
| Molecular Weight | 327.36 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | ethyl 13-fluoro-8-methoxy-2-azatetracyclo[7.6.1.05,16.010,15]hexadeca-5(16),6,8,10(15),11,13-hexaene-2-carboxylate |
| SMILES | CCOC(=O)N1CCc2ccc(OC)c3c2C1c1cc(F)ccc1-3 |
| InChI | InChI=1S/C19H18FNO3/c1-3-24-19(22)21-9-8-11-4-7-15(23-2)17-13-6-5-12(20)10-14(13)18(21)16(11)17/h4-7,10,18H,3,8-9H2,1-2H3 |
| InChIKey | WTXUPJRNRYRJFY-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.36 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |