C22H25NO6 — CID 71606930
ethyl 6,7,8,13-tetramethoxy-2-azatetracyclo[7.6.1.05,16.010,15]hexadeca-5(16),6,8,10(15),11,13-hexaene-2-carboxylate (PubChem CID 71606930) has the molecular formula C22H25NO6 and a molecular weight of 399.44 g/mol. Its IUPAC name is ethyl 6,7,8,13-tetramethoxy-2-azatetracyclo[7.6.1.05,16.010,15]hexadeca-5(16),6,8,10(15),11,13-hexaene-2-carboxylate.
| Compound Name | ethyl 6,7,8,13-tetramethoxy-2-azatetracyclo[7.6.1.05,16.010,15]hexadeca-5(16),6,8,10(15),11,13-hexaene-2-carboxylate |
|---|---|
| PubChem CID | 71606930 |
| Molecular Formula | C22H25NO6 |
| Molecular Weight | 399.44 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | ethyl 6,7,8,13-tetramethoxy-2-azatetracyclo[7.6.1.05,16.010,15]hexadeca-5(16),6,8,10(15),11,13-hexaene-2-carboxylate |
| SMILES | CCOC(=O)N1CCc2c(OC)c(OC)c(OC)c3c2C1c1cc(OC)ccc1-3 |
| InChI | InChI=1S/C22H25NO6/c1-6-29-22(24)23-10-9-14-16-17(20(27-4)21(28-5)19(14)26-3)13-8-7-12(25-2)11-15(13)18(16)23/h7-8,11,18H,6,9-10H2,1-5H3 |
| InChIKey | YPDGVEROFDEWHY-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.44 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |