C19H21NO4 — CID 162914595
1,9-dimethoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-2,7-diol (PubChem CID 162914595) has the molecular formula C19H21NO4 and a molecular weight of 327.38 g/mol. Its IUPAC name is 1,9-dimethoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-2,7-diol.
| Compound Name | 1,9-dimethoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-2,7-diol |
|---|---|
| PubChem CID | 162914595 |
| Molecular Formula | C19H21NO4 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | 1,9-dimethoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-2,7-diol |
| SMILES | COc1ccc2c(c1)C(O)C1c3c(cc(O)c(OC)c3-2)CCN1C |
| InChI | InChI=1S/C19H21NO4/c1-20-7-6-10-8-14(21)19(24-3)16-12-5-4-11(23-2)9-13(12)18(22)17(20)15(10)16/h4-5,8-9,17-18,21-22H,6-7H2,1-3H3 |
| InChIKey | DTFYFRUDZJDDCD-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |