C19H22N2O3 — CID 159930923
8-amino-1-methoxy-6,10-dimethyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-2,9-diol (PubChem CID 159930923) has the molecular formula C19H22N2O3 and a molecular weight of 326.40 g/mol. Its IUPAC name is 8-amino-1-methoxy-6,10-dimethyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-2,9-diol.
| Compound Name | 8-amino-1-methoxy-6,10-dimethyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-2,9-diol |
|---|---|
| PubChem CID | 159930923 |
| Molecular Formula | C19H22N2O3 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | 8-amino-1-methoxy-6,10-dimethyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-2,9-diol |
| SMILES | COc1c(O)cc2c3c1-c1cc(C)c(O)c(N)c1CC3N(C)CC2 |
| InChI | InChI=1S/C19H22N2O3/c1-9-6-11-12(17(20)18(9)23)8-13-15-10(4-5-21(13)2)7-14(22)19(24-3)16(11)15/h6-7,13,22-23H,4-5,8,20H2,1-3H3 |
| InChIKey | LIQWHMYBFBGUJX-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|