C21H25NO4 — CID 162988763
3,4-dimethoxy-11,16-dimethyl-11-azatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),2,4,6,14(18),15-hexaene-5,17-diol (PubChem CID 162988763) has the molecular formula C21H25NO4 and a molecular weight of 355.43 g/mol. Its IUPAC name is 3,4-dimethoxy-11,16-dimethyl-11-azatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),2,4,6,14(18),15-hexaene-5,17-diol.
| Compound Name | 3,4-dimethoxy-11,16-dimethyl-11-azatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),2,4,6,14(18),15-hexaene-5,17-diol |
|---|---|
| PubChem CID | 162988763 |
| Molecular Formula | C21H25NO4 |
| Molecular Weight | 355.43 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | 3,4-dimethoxy-11,16-dimethyl-11-azatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),2,4,6,14(18),15-hexaene-5,17-diol |
| SMILES | COc1c(O)cc2c(c1OC)-c1c(O)c(C)cc3c1C(CC2)N(C)CC3 |
| InChI | InChI=1S/C21H25NO4/c1-11-9-13-7-8-22(2)14-6-5-12-10-15(23)20(25-3)21(26-4)17(12)18(16(13)14)19(11)24/h9-10,14,23-24H,5-8H2,1-4H3 |
| InChIKey | DDXHVVWNQKETMA-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.43 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |