C22H25NO6 — CID 70683790
(10S)-17-hydroxy-3,4,5,16-tetramethoxy-11-methyl-11-azatetracyclo[8.7.1.02,7.014,18]octadeca-1(18),2,4,6,14,16-hexaen-13-one (PubChem CID 70683790) has the molecular formula C22H25NO6 and a molecular weight of 399.44 g/mol. Its IUPAC name is (10S)-17-hydroxy-3,4,5,16-tetramethoxy-11-methyl-11-azatetracyclo[8.7.1.02,7.014,18]octadeca-1(18),2,4,6,14,16-hexaen-13-one.
| Compound Name | (10S)-17-hydroxy-3,4,5,16-tetramethoxy-11-methyl-11-azatetracyclo[8.7.1.02,7.014,18]octadeca-1(18),2,4,6,14,16-hexaen-13-one |
|---|---|
| PubChem CID | 70683790 |
| Molecular Formula | C22H25NO6 |
| Molecular Weight | 399.44 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | (10S)-17-hydroxy-3,4,5,16-tetramethoxy-11-methyl-11-azatetracyclo[8.7.1.02,7.014,18]octadeca-1(18),2,4,6,14,16-hexaen-13-one |
| SMILES | COc1cc2c3c(c1O)-c1c(cc(OC)c(OC)c1OC)CC[C@@H]3N(C)CC2=O |
| InChI | InChI=1S/C22H25NO6/c1-23-10-14(24)12-9-15(26-2)20(25)19-17-11(6-7-13(23)18(12)19)8-16(27-3)21(28-4)22(17)29-5/h8-9,13,25H,6-7,10H2,1-5H3/t13-/m0/s1 |
| InChIKey | NJPPDFNBRLXOQD-ZDUSSCGKSA-N |
| XLogP | 3.21 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.44 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |