C24H30O7 — CID 11327880
(3-hydroxy-8,13,14,15-tetramethoxy-4-propyl-6-tricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaenyl) acetate (PubChem CID 11327880) has the molecular formula C24H30O7 and a molecular weight of 430.50 g/mol. Its IUPAC name is (3-hydroxy-8,13,14,15-tetramethoxy-4-propyl-6-tricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaenyl) acetate.
| Compound Name | (3-hydroxy-8,13,14,15-tetramethoxy-4-propyl-6-tricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaenyl) acetate |
|---|---|
| PubChem CID | 11327880 |
| Molecular Formula | C24H30O7 |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | (3-hydroxy-8,13,14,15-tetramethoxy-4-propyl-6-tricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaenyl) acetate |
| SMILES | CCCc1cc(OC(C)=O)c2c(c1O)-c1c(cc(OC)c(OC)c1OC)CCC2OC |
| InChI | InChI=1S/C24H30O7/c1-7-8-15-12-17(31-13(2)25)20-16(27-3)10-9-14-11-18(28-4)23(29-5)24(30-6)19(14)21(20)22(15)26/h11-12,16,26H,7-10H2,1-6H3 |
| InChIKey | OTBUZFWWFGRFRZ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|