C20H24N2O3 — CID 158495925
1-methoxy-6,10-dimethyl-8-(methylamino)-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-2,9-diol (PubChem CID 158495925) has the molecular formula C20H24N2O3 and a molecular weight of 340.42 g/mol. Its IUPAC name is 1-methoxy-6,10-dimethyl-8-(methylamino)-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-2,9-diol.
| Compound Name | 1-methoxy-6,10-dimethyl-8-(methylamino)-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-2,9-diol |
|---|---|
| PubChem CID | 158495925 |
| Molecular Formula | C20H24N2O3 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | 1-methoxy-6,10-dimethyl-8-(methylamino)-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-2,9-diol |
| SMILES | CNc1c(O)c(C)cc2c1CC1c3c(cc(O)c(OC)c3-2)CCN1C |
| InChI | InChI=1S/C20H24N2O3/c1-10-7-12-13(18(21-2)19(10)24)9-14-16-11(5-6-22(14)3)8-15(23)20(25-4)17(12)16/h7-8,14,21,23-24H,5-6,9H2,1-4H3 |
| InChIKey | VDQNTUCIHOXPKO-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 64.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|