C11H17NO5 — CID 102191065
(3aR,4R,6R,7R,7aS)-7-hydroxy-4-methoxy-2,2,6-trimethyl-3a,4,6,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-7-carbonitrile (PubChem CID 102191065) has the molecular formula C11H17NO5 and a molecular weight of 243.26 g/mol. Its IUPAC name is (3aR,4R,6R,7R,7aS)-7-hydroxy-4-methoxy-2,2,6-trimethyl-3a,4,6,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-7-carbonitrile.
| Compound Name | (3aR,4R,6R,7R,7aS)-7-hydroxy-4-methoxy-2,2,6-trimethyl-3a,4,6,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-7-carbonitrile |
|---|---|
| PubChem CID | 102191065 |
| Molecular Formula | C11H17NO5 |
| Molecular Weight | 243.26 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | (3aR,4R,6R,7R,7aS)-7-hydroxy-4-methoxy-2,2,6-trimethyl-3a,4,6,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-7-carbonitrile |
| SMILES | CO[C@@H]1O[C@H](C)[C@](O)(C#N)[C@H]2OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C11H17NO5/c1-6-11(13,5-12)8-7(9(14-4)15-6)16-10(2,3)17-8/h6-9,13H,1-4H3/t6-,7-,8+,9-,11-/m1/s1 |
| InChIKey | PEGYLAASNJQPQA-ZBGLXGBJSA-N |
| XLogP | 0.15 |
| TPSA | 80.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.26 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'} |
|---|