C12H18O6 — CID 102191168
1-O-[(3R)-4,4-dimethyl-2-oxooxolan-3-yl] 4-O-methyl 2-methylbutanedioate (PubChem CID 102191168) has the molecular formula C12H18O6 and a molecular weight of 258.27 g/mol. Its IUPAC name is 1-O-[(3R)-4,4-dimethyl-2-oxooxolan-3-yl] 4-O-methyl 2-methylbutanedioate.
| Compound Name | 1-O-[(3R)-4,4-dimethyl-2-oxooxolan-3-yl] 4-O-methyl 2-methylbutanedioate |
|---|---|
| PubChem CID | 102191168 |
| Molecular Formula | C12H18O6 |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | 1-O-[(3R)-4,4-dimethyl-2-oxooxolan-3-yl] 4-O-methyl 2-methylbutanedioate |
| SMILES | COC(=O)CC(C)C(=O)O[C@H]1C(=O)OCC1(C)C |
| InChI | InChI=1S/C12H18O6/c1-7(5-8(13)16-4)10(14)18-9-11(15)17-6-12(9,2)3/h7,9H,5-6H2,1-4H3/t7?,9-/m0/s1 |
| InChIKey | BOYSBQRBFDNFCM-NETXQHHPSA-N |
| XLogP | 0.68 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|