C14H24OSi — CID 102192364
1-(cyclohexen-1-yl)pent-4-ynoxy-trimethylsilane (PubChem CID 102192364) has the molecular formula C14H24OSi and a molecular weight of 236.43 g/mol. Its IUPAC name is 1-(cyclohexen-1-yl)pent-4-ynoxy-trimethylsilane.
| Compound Name | 1-(cyclohexen-1-yl)pent-4-ynoxy-trimethylsilane |
|---|---|
| PubChem CID | 102192364 |
| Molecular Formula | C14H24OSi |
| Molecular Weight | 236.43 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | 1-(cyclohexen-1-yl)pent-4-ynoxy-trimethylsilane |
| SMILES | C#CCCC(O[Si](C)(C)C)C1=CCCCC1 |
| InChI | InChI=1S/C14H24OSi/c1-5-6-12-14(15-16(2,3)4)13-10-8-7-9-11-13/h1,10,14H,6-9,11-12H2,2-4H3 |
| InChIKey | JPLYEZNZWVYFFS-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.43 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|