C16H30OSi — CID 146163106
tert-butyl-[(Z)-dec-3-en-1-yn-5-yl]oxy-dimethylsilane (PubChem CID 146163106) has the molecular formula C16H30OSi and a molecular weight of 266.50 g/mol. Its IUPAC name is tert-butyl-[(Z)-dec-3-en-1-yn-5-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(Z)-dec-3-en-1-yn-5-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 146163106 |
| Molecular Formula | C16H30OSi |
| Molecular Weight | 266.50 g/mol |
| Exact Mass | 266.21 |
| IUPAC Name | tert-butyl-[(Z)-dec-3-en-1-yn-5-yl]oxy-dimethylsilane |
| SMILES | C#C/C=C\C(CCCCC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H30OSi/c1-8-10-12-14-15(13-11-9-2)17-18(6,7)16(3,4)5/h2,11,13,15H,8,10,12,14H2,1,3-7H3/b13-11- |
| InChIKey | LWNGQVYWLWWKIL-QBFSEMIESA-N |
| XLogP | 5.15 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.50 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|