C8H11ClO2 — CID 102192945
3a-chloro-3,4,5,6,7,7a-hexahydro-1-benzofuran-2-one (PubChem CID 102192945) has the molecular formula C8H11ClO2 and a molecular weight of 174.63 g/mol. Its IUPAC name is 3a-chloro-3,4,5,6,7,7a-hexahydro-1-benzofuran-2-one.
| Compound Name | 3a-chloro-3,4,5,6,7,7a-hexahydro-1-benzofuran-2-one |
|---|---|
| PubChem CID | 102192945 |
| Molecular Formula | C8H11ClO2 |
| Molecular Weight | 174.63 g/mol |
| Exact Mass | 174.04 |
| IUPAC Name | 3a-chloro-3,4,5,6,7,7a-hexahydro-1-benzofuran-2-one |
| SMILES | O=C1CC2(Cl)CCCCC2O1 |
| InChI | InChI=1S/C8H11ClO2/c9-8-4-2-1-3-6(8)11-7(10)5-8/h6H,1-5H2 |
| InChIKey | UDIBHYXPAWCQOK-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.63 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|